C21H24FNO5 — CID 67441214
[4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 3-fluorobenzoate (PubChem CID 67441214) has the molecular formula C21H24FNO5 and a molecular weight of 389.42 g/mol. Its IUPAC name is [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 3-fluorobenzoate.
| Compound Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 67441214 |
| Molecular Formula | C21H24FNO5 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 3-fluorobenzoate |
| SMILES | CN(CC(O)c1ccc(OC(=O)c2cccc(F)c2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H24FNO5/c1-21(2,3)28-20(26)23(4)13-18(24)14-8-10-17(11-9-14)27-19(25)15-6-5-7-16(22)12-15/h5-12,18,24H,13H2,1-4H3 |
| InChIKey | YDCFWAFLDGBGCP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|