C24H33NO6S — CID 87401666
[4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-butylbenzenesulfonate (PubChem CID 87401666) has the molecular formula C24H33NO6S and a molecular weight of 463.60 g/mol. Its IUPAC name is [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-butylbenzenesulfonate.
| Compound Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-butylbenzenesulfonate |
|---|---|
| PubChem CID | 87401666 |
| Molecular Formula | C24H33NO6S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-butylbenzenesulfonate |
| SMILES | CCCCc1ccc(S(=O)(=O)Oc2ccc(C(O)CN(C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H33NO6S/c1-6-7-8-18-9-15-21(16-10-18)32(28,29)31-20-13-11-19(12-14-20)22(26)17-25(5)23(27)30-24(2,3)4/h9-16,22,26H,6-8,17H2,1-5H3 |
| InChIKey | SIYWONWRQOQKGR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|