C18H29ClN2O3 — CID 59364377
tert-butyl N-[3-(2-aminoethoxy)-3-(5-chloro-2-methylphenyl)propyl]-N-methylcarbamate (PubChem CID 59364377) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is tert-butyl N-[3-(2-aminoethoxy)-3-(5-chloro-2-methylphenyl)propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(2-aminoethoxy)-3-(5-chloro-2-methylphenyl)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59364377 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | tert-butyl N-[3-(2-aminoethoxy)-3-(5-chloro-2-methylphenyl)propyl]-N-methylcarbamate |
| SMILES | Cc1ccc(Cl)cc1C(CCN(C)C(=O)OC(C)(C)C)OCCN |
| InChI | InChI=1S/C18H29ClN2O3/c1-13-6-7-14(19)12-15(13)16(23-11-9-20)8-10-21(5)17(22)24-18(2,3)4/h6-7,12,16H,8-11,20H2,1-5H3 |
| InChIKey | ZTBIHTMTJXGRJG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |