tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate

C16H24ClNO2 — CID 115590823

IUPACtert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate
SMILESCC(c1ccc(Cl)cc1)N(C)CCC(=O)OC(C)(C)C
InChIInChI=1S/C16H24ClNO2/c1-12(13-6-8-14(17)9-7-13)18(5)11-10-15(19)20-16(2,3)4/h6-9,12H,10-11H2,1-5H3
InChIKeySTEQYRMYRUUMLH-UHFFFAOYSA-N
MW297.83 g/mol
LogP4.06
Rot. Bonds5

About tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate

tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate (PubChem CID 115590823) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate.

Molecular Properties

Compound Nametert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate
PubChem CID115590823
Molecular FormulaC16H24ClNO2
Molecular Weight297.83 g/mol
Exact Mass297.15
IUPAC Nametert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate
SMILESCC(c1ccc(Cl)cc1)N(C)CCC(=O)OC(C)(C)C
InChIInChI=1S/C16H24ClNO2/c1-12(13-6-8-14(17)9-7-13)18(5)11-10-15(19)20-16(2,3)4/h6-9,12H,10-11H2,1-5H3
InChIKeySTEQYRMYRUUMLH-UHFFFAOYSA-N
XLogP4.06
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.83
LogP ≤ 54.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate?
The IUPAC name of tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate (CID 115590823) is tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate.
What is the SMILES notation for tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate?
The canonical SMILES for tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate is CC(c1ccc(Cl)cc1)N(C)CCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate?
The InChIKey is STEQYRMYRUUMLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClNO2/c1-12(13-6-8-14(17)9-7-13)18(5)11-10-15(19)20-16(2,3)4/h6-9,12H,10-11H2,1-5H3.
What are the key properties of tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate?
tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate has a molecular weight of 297.83 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate is sourced from PubChem (CID 115590823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).