C16H24ClNO2 — CID 115590823
tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate (PubChem CID 115590823) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate.
| Compound Name | tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate |
|---|---|
| PubChem CID | 115590823 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | tert-butyl 3-[1-(4-chlorophenyl)ethyl-methylamino]propanoate |
| SMILES | CC(c1ccc(Cl)cc1)N(C)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24ClNO2/c1-12(13-6-8-14(17)9-7-13)18(5)11-10-15(19)20-16(2,3)4/h6-9,12H,10-11H2,1-5H3 |
| InChIKey | STEQYRMYRUUMLH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |