C16H25N3O3 — CID 87090981
tert-butyl 2-[1-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl-methylamino]acetate (PubChem CID 87090981) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl-methylamino]acetate.
| Compound Name | tert-butyl 2-[1-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl-methylamino]acetate |
|---|---|
| PubChem CID | 87090981 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl 2-[1-[4-(N'-hydroxycarbamimidoyl)phenyl]ethyl-methylamino]acetate |
| SMILES | CC(c1ccc(C(N)=NO)cc1)N(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O3/c1-11(19(5)10-14(20)22-16(2,3)4)12-6-8-13(9-7-12)15(17)18-21/h6-9,11,21H,10H2,1-5H3,(H2,17,18) |
| InChIKey | ACZCUMNKRUGMDJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|