C15H22N2O5 — CID 90815141
tert-butyl [(2S)-1-hydroxy-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propan-2-yl] carbonate (PubChem CID 90815141) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl [(2S)-1-hydroxy-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propan-2-yl] carbonate.
| Compound Name | tert-butyl [(2S)-1-hydroxy-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propan-2-yl] carbonate |
|---|---|
| PubChem CID | 90815141 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl [(2S)-1-hydroxy-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propan-2-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)O[C@H](CO)Cc1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C15H22N2O5/c1-15(2,3)22-14(19)21-12(9-18)8-10-4-6-11(7-5-10)13(16)17-20/h4-7,12,18,20H,8-9H2,1-3H3,(H2,16,17)/t12-/m0/s1 |
| InChIKey | KNRRDVNGDIUJKV-LBPRGKRZSA-N |
| XLogP | 1.64 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|