C14H20ClNO — CID 55140473
3-[1-(4-chlorophenyl)ethyl-methylamino]-2,2-dimethylpropanal (PubChem CID 55140473) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)ethyl-methylamino]-2,2-dimethylpropanal.
| Compound Name | 3-[1-(4-chlorophenyl)ethyl-methylamino]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 55140473 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-[1-(4-chlorophenyl)ethyl-methylamino]-2,2-dimethylpropanal |
| SMILES | CC(c1ccc(Cl)cc1)N(C)CC(C)(C)C=O |
| InChI | InChI=1S/C14H20ClNO/c1-11(12-5-7-13(15)8-6-12)16(4)9-14(2,3)10-17/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | NJAHFPCRVWGKDD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|