C13H18ClNO — CID 62278141
3-[(4-chlorophenyl)methyl-methylamino]-2,2-dimethylpropanal (PubChem CID 62278141) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl-methylamino]-2,2-dimethylpropanal.
| Compound Name | 3-[(4-chlorophenyl)methyl-methylamino]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 62278141 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl-methylamino]-2,2-dimethylpropanal |
| SMILES | CN(Cc1ccc(Cl)cc1)CC(C)(C)C=O |
| InChI | InChI=1S/C13H18ClNO/c1-13(2,10-16)9-15(3)8-11-4-6-12(14)7-5-11/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | DKYGRDZPUXJJID-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|