C18H24Cl2O3 — CID 164971192
tert-butyl 7-(3,5-dichlorophenyl)-4-methyl-7-oxoheptanoate (PubChem CID 164971192) has the molecular formula C18H24Cl2O3 and a molecular weight of 359.29 g/mol. Its IUPAC name is tert-butyl 7-(3,5-dichlorophenyl)-4-methyl-7-oxoheptanoate.
| Compound Name | tert-butyl 7-(3,5-dichlorophenyl)-4-methyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 164971192 |
| Molecular Formula | C18H24Cl2O3 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | tert-butyl 7-(3,5-dichlorophenyl)-4-methyl-7-oxoheptanoate |
| SMILES | CC(CCC(=O)OC(C)(C)C)CCC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H24Cl2O3/c1-12(6-8-17(22)23-18(2,3)4)5-7-16(21)13-9-14(19)11-15(20)10-13/h9-12H,5-8H2,1-4H3 |
| InChIKey | OZZJUBVZIXMYIP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |