C17H25ClO2 — CID 146249327
1-(4-chlorophenyl)-8-hydroxy-4,8-dimethylnonan-1-one (PubChem CID 146249327) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-8-hydroxy-4,8-dimethylnonan-1-one.
| Compound Name | 1-(4-chlorophenyl)-8-hydroxy-4,8-dimethylnonan-1-one |
|---|---|
| PubChem CID | 146249327 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-(4-chlorophenyl)-8-hydroxy-4,8-dimethylnonan-1-one |
| SMILES | CC(CCCC(C)(C)O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H25ClO2/c1-13(5-4-12-17(2,3)20)6-11-16(19)14-7-9-15(18)10-8-14/h7-10,13,20H,4-6,11-12H2,1-3H3 |
| InChIKey | ZOEDCAWQEAMCFJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |