C19H26ClNO8 — CID 66753702
2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoic acid (PubChem CID 66753702) has the molecular formula C19H26ClNO8 and a molecular weight of 431.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoic acid.
| Compound Name | 2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 66753702 |
| Molecular Formula | C19H26ClNO8 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoic acid |
| SMILES | CCOC(C)(OCC)C(=O)OCOC(=O)NCCC(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H26ClNO8/c1-4-28-19(3,29-5-2)17(24)26-12-27-18(25)21-11-10-15(16(22)23)13-6-8-14(20)9-7-13/h6-9,15H,4-5,10-12H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | FHIKBJRPVLDNAC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|