C22H31ClNNaO6 — CID 173194013
sodium;[1-[[1-(4-chlorophenoxy)-1-oxobutan-2-yl]carbamoyloxy]-2-methylpropyl] cyclohexanecarboxylate;hydride (PubChem CID 173194013) has the molecular formula C22H31ClNNaO6 and a molecular weight of 463.93 g/mol. Its IUPAC name is sodium;[1-[[1-(4-chlorophenoxy)-1-oxobutan-2-yl]carbamoyloxy]-2-methylpropyl] cyclohexanecarboxylate;hydride.
| Compound Name | sodium;[1-[[1-(4-chlorophenoxy)-1-oxobutan-2-yl]carbamoyloxy]-2-methylpropyl] cyclohexanecarboxylate;hydride |
|---|---|
| PubChem CID | 173194013 |
| Molecular Formula | C22H31ClNNaO6 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | sodium;[1-[[1-(4-chlorophenoxy)-1-oxobutan-2-yl]carbamoyloxy]-2-methylpropyl] cyclohexanecarboxylate;hydride |
| SMILES | CCC(NC(=O)OC(OC(=O)C1CCCCC1)C(C)C)C(=O)Oc1ccc(Cl)cc1.[H-].[Na+] |
| InChI | InChI=1S/C22H30ClNO6.Na.H/c1-4-18(20(26)28-17-12-10-16(23)11-13-17)24-22(27)30-21(14(2)3)29-19(25)15-8-6-5-7-9-15;;/h10-15,18,21H,4-9H2,1-3H3,(H,24,27);;/q;+1;-1 |
| InChIKey | LKUIJHRRODTUHS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|