C20H27ClNNaO6 — CID 173024041
sodium;(4-chlorophenyl) 4-[[acetyloxy(cyclohexyl)methoxy]carbonylamino]butanoate;hydride (PubChem CID 173024041) has the molecular formula C20H27ClNNaO6 and a molecular weight of 435.88 g/mol. Its IUPAC name is sodium;(4-chlorophenyl) 4-[[acetyloxy(cyclohexyl)methoxy]carbonylamino]butanoate;hydride.
| Compound Name | sodium;(4-chlorophenyl) 4-[[acetyloxy(cyclohexyl)methoxy]carbonylamino]butanoate;hydride |
|---|---|
| PubChem CID | 173024041 |
| Molecular Formula | C20H27ClNNaO6 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | sodium;(4-chlorophenyl) 4-[[acetyloxy(cyclohexyl)methoxy]carbonylamino]butanoate;hydride |
| SMILES | CC(=O)OC(OC(=O)NCCCC(=O)Oc1ccc(Cl)cc1)C1CCCCC1.[H-].[Na+] |
| InChI | InChI=1S/C20H26ClNO6.Na.H/c1-14(23)26-19(15-6-3-2-4-7-15)28-20(25)22-13-5-8-18(24)27-17-11-9-16(21)10-12-17;;/h9-12,15,19H,2-8,13H2,1H3,(H,22,25);;/q;+1;-1 |
| InChIKey | OUFJIXHBGFWQOF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|