C19H26ClNO6 — CID 66755194
(4-chlorophenyl) 4-[[(1S)-1-butanoyloxybutoxy]carbonylamino]butanoate (PubChem CID 66755194) has the molecular formula C19H26ClNO6 and a molecular weight of 399.87 g/mol. Its IUPAC name is (4-chlorophenyl) 4-[[(1S)-1-butanoyloxybutoxy]carbonylamino]butanoate.
| Compound Name | (4-chlorophenyl) 4-[[(1S)-1-butanoyloxybutoxy]carbonylamino]butanoate |
|---|---|
| PubChem CID | 66755194 |
| Molecular Formula | C19H26ClNO6 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (4-chlorophenyl) 4-[[(1S)-1-butanoyloxybutoxy]carbonylamino]butanoate |
| SMILES | CCCC(=O)O[C@H](CCC)OC(=O)NCCCC(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H26ClNO6/c1-3-6-16(22)26-18(7-4-2)27-19(24)21-13-5-8-17(23)25-15-11-9-14(20)10-12-15/h9-12,18H,3-8,13H2,1-2H3,(H,21,24)/t18-/m0/s1 |
| InChIKey | OHEDOHGWVUUYAK-SFHVURJKSA-N |
| XLogP | 4.22 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|