C19H33NO4 — CID 68568677
[1-(cyclohexylmethylcarbamoyloxy)-2-methylpropyl] cyclohexanecarboxylate (PubChem CID 68568677) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is [1-(cyclohexylmethylcarbamoyloxy)-2-methylpropyl] cyclohexanecarboxylate.
| Compound Name | [1-(cyclohexylmethylcarbamoyloxy)-2-methylpropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 68568677 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | [1-(cyclohexylmethylcarbamoyloxy)-2-methylpropyl] cyclohexanecarboxylate |
| SMILES | CC(C)C(OC(=O)NCC1CCCCC1)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H33NO4/c1-14(2)18(23-17(21)16-11-7-4-8-12-16)24-19(22)20-13-15-9-5-3-6-10-15/h14-16,18H,3-13H2,1-2H3,(H,20,22) |
| InChIKey | ODFUXPMOXUMZHT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|