C16H31NO5 — CID 59928754
2,6,8-trihydroxynonan-4-yl N-(cyclopentylmethyl)carbamate (PubChem CID 59928754) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2,6,8-trihydroxynonan-4-yl N-(cyclopentylmethyl)carbamate.
| Compound Name | 2,6,8-trihydroxynonan-4-yl N-(cyclopentylmethyl)carbamate |
|---|---|
| PubChem CID | 59928754 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 2,6,8-trihydroxynonan-4-yl N-(cyclopentylmethyl)carbamate |
| SMILES | CC(O)CC(O)CC(CC(C)O)OC(=O)NCC1CCCC1 |
| InChI | InChI=1S/C16H31NO5/c1-11(18)7-14(20)9-15(8-12(2)19)22-16(21)17-10-13-5-3-4-6-13/h11-15,18-20H,3-10H2,1-2H3,(H,17,21) |
| InChIKey | WBFAUCSBTARWDX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |