C15H27NO6 — CID 68798909
acetic acid;1-(cyclohexylmethylcarbamoyloxy)propyl acetate (PubChem CID 68798909) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is acetic acid;1-(cyclohexylmethylcarbamoyloxy)propyl acetate.
| Compound Name | acetic acid;1-(cyclohexylmethylcarbamoyloxy)propyl acetate |
|---|---|
| PubChem CID | 68798909 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | acetic acid;1-(cyclohexylmethylcarbamoyloxy)propyl acetate |
| SMILES | CC(=O)O.CCC(OC(C)=O)OC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C13H23NO4.C2H4O2/c1-3-12(17-10(2)15)18-13(16)14-9-11-7-5-4-6-8-11;1-2(3)4/h11-12H,3-9H2,1-2H3,(H,14,16);1H3,(H,3,4) |
| InChIKey | KBGZHKRHFJZSHS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|