C20H35NO7 — CID 68567866
carbonic acid;[cyclohexyl(cyclohexylmethylcarbamoyloxy)methyl] butanoate (PubChem CID 68567866) has the molecular formula C20H35NO7 and a molecular weight of 401.50 g/mol. Its IUPAC name is carbonic acid;[cyclohexyl(cyclohexylmethylcarbamoyloxy)methyl] butanoate.
| Compound Name | carbonic acid;[cyclohexyl(cyclohexylmethylcarbamoyloxy)methyl] butanoate |
|---|---|
| PubChem CID | 68567866 |
| Molecular Formula | C20H35NO7 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | carbonic acid;[cyclohexyl(cyclohexylmethylcarbamoyloxy)methyl] butanoate |
| SMILES | CCCC(=O)OC(OC(=O)NCC1CCCCC1)C1CCCCC1.O=C(O)O |
| InChI | InChI=1S/C19H33NO4.CH2O3/c1-2-9-17(21)23-18(16-12-7-4-8-13-16)24-19(22)20-14-15-10-5-3-6-11-15;2-1(3)4/h15-16,18H,2-14H2,1H3,(H,20,22);(H2,2,3,4) |
| InChIKey | XOJMRUCBSPGWBX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|