C14H25N3O6 — CID 140520556
[1-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 2-methylpropanoate (PubChem CID 140520556) has the molecular formula C14H25N3O6 and a molecular weight of 331.37 g/mol. Its IUPAC name is [1-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 2-methylpropanoate.
| Compound Name | [1-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 140520556 |
| Molecular Formula | C14H25N3O6 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | [1-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 2-methylpropanoate |
| SMILES | [H]/N=C(/NC(=O)OC(OC(=O)C(C)C)C(C)C)N(C)CC(=O)OC |
| InChI | InChI=1S/C14H25N3O6/c1-8(2)11(19)22-12(9(3)4)23-14(20)16-13(15)17(5)7-10(18)21-6/h8-9,12H,7H2,1-6H3,(H2,15,16,20) |
| InChIKey | NQYCBUYPKXPPCB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|