C16H21N3O6 — CID 140520575
2-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]ethyl 2-phenylacetate (PubChem CID 140520575) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]ethyl 2-phenylacetate.
| Compound Name | 2-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]ethyl 2-phenylacetate |
|---|---|
| PubChem CID | 140520575 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[[N-(2-methoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]ethyl 2-phenylacetate |
| SMILES | [H]/N=C(/NC(=O)OCCOC(=O)Cc1ccccc1)N(C)CC(=O)OC |
| InChI | InChI=1S/C16H21N3O6/c1-19(11-14(21)23-2)15(17)18-16(22)25-9-8-24-13(20)10-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3,(H2,17,18,22) |
| InChIKey | DHBIAHKFSJYPLJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|