C19H27N3O6 — CID 173166074
2-[methyl-[N-[2-methyl-3-(2-phenylacetyl)oxypropoxy]carbonylcarbamimidoyl]amino]butanoic acid (PubChem CID 173166074) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[methyl-[N-[2-methyl-3-(2-phenylacetyl)oxypropoxy]carbonylcarbamimidoyl]amino]butanoic acid.
| Compound Name | 2-[methyl-[N-[2-methyl-3-(2-phenylacetyl)oxypropoxy]carbonylcarbamimidoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 173166074 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[methyl-[N-[2-methyl-3-(2-phenylacetyl)oxypropoxy]carbonylcarbamimidoyl]amino]butanoic acid |
| SMILES | [H]/N=C(/NC(=O)OCC(C)COC(=O)Cc1ccccc1)N(C)C(CC)C(=O)O |
| InChI | InChI=1S/C19H27N3O6/c1-4-15(17(24)25)22(3)18(20)21-19(26)28-12-13(2)11-27-16(23)10-14-8-6-5-7-9-14/h5-9,13,15H,4,10-12H2,1-3H3,(H,24,25)(H2,20,21,26) |
| InChIKey | TUDYFWQSBSLMJE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|