C19H27N3O6 — CID 87838840
2-[methyl-[N-(2-methylpropoxycarbonyl)-N-(2-phenylacetyl)oxycarbamimidoyl]amino]butanoic acid (PubChem CID 87838840) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[methyl-[N-(2-methylpropoxycarbonyl)-N-(2-phenylacetyl)oxycarbamimidoyl]amino]butanoic acid.
| Compound Name | 2-[methyl-[N-(2-methylpropoxycarbonyl)-N-(2-phenylacetyl)oxycarbamimidoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 87838840 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[methyl-[N-(2-methylpropoxycarbonyl)-N-(2-phenylacetyl)oxycarbamimidoyl]amino]butanoic acid |
| SMILES | [H]/N=C(/N(OC(=O)Cc1ccccc1)C(=O)OCC(C)C)N(C)C(CC)C(=O)O |
| InChI | InChI=1S/C19H27N3O6/c1-5-15(17(24)25)21(4)18(20)22(19(26)27-12-13(2)3)28-16(23)11-14-9-7-6-8-10-14/h6-10,13,15,20H,5,11-12H2,1-4H3,(H,24,25)/b20-18+ |
| InChIKey | QVHUFJOFEYENID-CZIZESTLSA-N |
| XLogP | 2.51 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|