About 2,2-dichloroethyl 2-phenylacetate
2,2-dichloroethyl 2-phenylacetate (PubChem CID 102088308) has the molecular formula C10H10Cl2O2
and a molecular weight of 233.09 g/mol. Its IUPAC name is 2,2-dichloroethyl 2-phenylacetate.
Molecular Properties
| Compound Name | 2,2-dichloroethyl 2-phenylacetate |
| PubChem CID | 102088308 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2,2-dichloroethyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OCC(Cl)Cl |
| InChI | InChI=1S/C10H10Cl2O2/c11-9(12)7-14-10(13)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | AYTWDRQJJXPFKC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethyl 2-phenylacetate?
The IUPAC name of 2,2-dichloroethyl 2-phenylacetate (CID 102088308) is 2,2-dichloroethyl 2-phenylacetate.
What is the SMILES notation for 2,2-dichloroethyl 2-phenylacetate?
The canonical SMILES for 2,2-dichloroethyl 2-phenylacetate is O=C(Cc1ccccc1)OCC(Cl)Cl.
What is the InChIKey of 2,2-dichloroethyl 2-phenylacetate?
The InChIKey is AYTWDRQJJXPFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O2/c11-9(12)7-14-10(13)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of 2,2-dichloroethyl 2-phenylacetate?
2,2-dichloroethyl 2-phenylacetate has a molecular weight of 233.09 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethyl 2-phenylacetate is sourced from PubChem (CID 102088308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).