About acetyloxymethyl 2-phenylacetate
acetyloxymethyl 2-phenylacetate (PubChem CID 121486345) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is acetyloxymethyl 2-phenylacetate.
Molecular Properties
| Compound Name | acetyloxymethyl 2-phenylacetate |
| PubChem CID | 121486345 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | acetyloxymethyl 2-phenylacetate |
| SMILES | CC(=O)OCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H12O4/c1-9(12)14-8-15-11(13)7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | PRTPXKROYYHQGS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetyloxymethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxymethyl 2-phenylacetate?
The IUPAC name of acetyloxymethyl 2-phenylacetate (CID 121486345) is acetyloxymethyl 2-phenylacetate.
What is the SMILES notation for acetyloxymethyl 2-phenylacetate?
The canonical SMILES for acetyloxymethyl 2-phenylacetate is CC(=O)OCOC(=O)Cc1ccccc1.
What is the InChIKey of acetyloxymethyl 2-phenylacetate?
The InChIKey is PRTPXKROYYHQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-9(12)14-8-15-11(13)7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3.
What are the key properties of acetyloxymethyl 2-phenylacetate?
acetyloxymethyl 2-phenylacetate has a molecular weight of 208.21 g/mol, XLogP of 1.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxymethyl 2-phenylacetate is sourced from PubChem (CID 121486345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).