About diaminomethylidenecarbamoyloxymethyl 2-phenylacetate
diaminomethylidenecarbamoyloxymethyl 2-phenylacetate (PubChem CID 146031564) has the molecular formula C11H13N3O4
and a molecular weight of 251.24 g/mol. Its IUPAC name is diaminomethylidenecarbamoyloxymethyl 2-phenylacetate.
Molecular Properties
| Compound Name | diaminomethylidenecarbamoyloxymethyl 2-phenylacetate |
| PubChem CID | 146031564 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | diaminomethylidenecarbamoyloxymethyl 2-phenylacetate |
| SMILES | NC(N)=NC(=O)OCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H13N3O4/c12-10(13)14-11(16)18-7-17-9(15)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,12,13,14,16) |
| InChIKey | GIWKMYXTIFQHKB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze diaminomethylidenecarbamoyloxymethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethylidenecarbamoyloxymethyl 2-phenylacetate?
The IUPAC name of diaminomethylidenecarbamoyloxymethyl 2-phenylacetate (CID 146031564) is diaminomethylidenecarbamoyloxymethyl 2-phenylacetate.
What is the SMILES notation for diaminomethylidenecarbamoyloxymethyl 2-phenylacetate?
The canonical SMILES for diaminomethylidenecarbamoyloxymethyl 2-phenylacetate is NC(N)=NC(=O)OCOC(=O)Cc1ccccc1.
What is the InChIKey of diaminomethylidenecarbamoyloxymethyl 2-phenylacetate?
The InChIKey is GIWKMYXTIFQHKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O4/c12-10(13)14-11(16)18-7-17-9(15)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,12,13,14,16).
What are the key properties of diaminomethylidenecarbamoyloxymethyl 2-phenylacetate?
diaminomethylidenecarbamoyloxymethyl 2-phenylacetate has a molecular weight of 251.24 g/mol, XLogP of 0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethylidenecarbamoyloxymethyl 2-phenylacetate is sourced from PubChem (CID 146031564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).