C21H31N3O6 — CID 140520569
4-[[N-(2-ethoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]butyl 4-phenylbutanoate (PubChem CID 140520569) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-[[N-(2-ethoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]butyl 4-phenylbutanoate.
| Compound Name | 4-[[N-(2-ethoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]butyl 4-phenylbutanoate |
|---|---|
| PubChem CID | 140520569 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 4-[[N-(2-ethoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]butyl 4-phenylbutanoate |
| SMILES | [H]/N=C(/NC(=O)OCCCCOC(=O)CCCc1ccccc1)N(C)CC(=O)OCC |
| InChI | InChI=1S/C21H31N3O6/c1-3-28-19(26)16-24(2)20(22)23-21(27)30-15-8-7-14-29-18(25)13-9-12-17-10-5-4-6-11-17/h4-6,10-11H,3,7-9,12-16H2,1-2H3,(H2,22,23,27) |
| InChIKey | DWKQMLULGZYXLL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|