C23H35N3O6 — CID 140520501
[1-[[N-(2-butoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 4-phenylbutanoate (PubChem CID 140520501) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is [1-[[N-(2-butoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 4-phenylbutanoate.
| Compound Name | [1-[[N-(2-butoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 4-phenylbutanoate |
|---|---|
| PubChem CID | 140520501 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | [1-[[N-(2-butoxy-2-oxoethyl)-N-methylcarbamimidoyl]carbamoyloxy]-2-methylpropyl] 4-phenylbutanoate |
| SMILES | [H]/N=C(/NC(=O)OC(OC(=O)CCCc1ccccc1)C(C)C)N(C)CC(=O)OCCCC |
| InChI | InChI=1S/C23H35N3O6/c1-5-6-15-30-20(28)16-26(4)22(24)25-23(29)32-21(17(2)3)31-19(27)14-10-13-18-11-8-7-9-12-18/h7-9,11-12,17,21H,5-6,10,13-16H2,1-4H3,(H2,24,25,29) |
| InChIKey | JAEFEYUBNRBVOT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|