C26H33N3O6 — CID 173166112
2-[methyl-[N-[2-methyl-1-(4-phenylbutanoyloxy)propoxy]carbonylcarbamimidoyl]amino]-3-phenylpropanoic acid (PubChem CID 173166112) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[methyl-[N-[2-methyl-1-(4-phenylbutanoyloxy)propoxy]carbonylcarbamimidoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[methyl-[N-[2-methyl-1-(4-phenylbutanoyloxy)propoxy]carbonylcarbamimidoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 173166112 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[methyl-[N-[2-methyl-1-(4-phenylbutanoyloxy)propoxy]carbonylcarbamimidoyl]amino]-3-phenylpropanoic acid |
| SMILES | [H]/N=C(\NC(=O)OC(OC(=O)CCCc1ccccc1)C(C)C)N(C)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H33N3O6/c1-18(2)24(34-22(30)16-10-15-19-11-6-4-7-12-19)35-26(33)28-25(27)29(3)21(23(31)32)17-20-13-8-5-9-14-20/h4-9,11-14,18,21,24H,10,15-17H2,1-3H3,(H,31,32)(H2,27,28,33) |
| InChIKey | VPNNWPPTODKFKF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|