C17H23N3O6 — CID 140520563
2-[methyl-[N-[2-(4-phenylbutanoyloxy)ethoxycarbonyl]carbamimidoyl]amino]acetic acid (PubChem CID 140520563) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-[methyl-[N-[2-(4-phenylbutanoyloxy)ethoxycarbonyl]carbamimidoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[N-[2-(4-phenylbutanoyloxy)ethoxycarbonyl]carbamimidoyl]amino]acetic acid |
|---|---|
| PubChem CID | 140520563 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[methyl-[N-[2-(4-phenylbutanoyloxy)ethoxycarbonyl]carbamimidoyl]amino]acetic acid |
| SMILES | [H]/N=C(/NC(=O)OCCOC(=O)CCCc1ccccc1)N(C)CC(=O)O |
| InChI | InChI=1S/C17H23N3O6/c1-20(12-14(21)22)16(18)19-17(24)26-11-10-25-15(23)9-5-8-13-6-3-2-4-7-13/h2-4,6-7H,5,8-12H2,1H3,(H,21,22)(H2,18,19,24) |
| InChIKey | GOWWQAXRZYJGMW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|