C11H20N2O2 — CID 177044189
5-methyl-N-[2-(methylamino)ethyl]-4-oxohept-5-enamide (PubChem CID 177044189) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-methyl-N-[2-(methylamino)ethyl]-4-oxohept-5-enamide.
| Compound Name | 5-methyl-N-[2-(methylamino)ethyl]-4-oxohept-5-enamide |
|---|---|
| PubChem CID | 177044189 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 5-methyl-N-[2-(methylamino)ethyl]-4-oxohept-5-enamide |
| SMILES | CC=C(C)C(=O)CCC(=O)NCCNC |
| InChI | InChI=1S/C11H20N2O2/c1-4-9(2)10(14)5-6-11(15)13-8-7-12-3/h4,12H,5-8H2,1-3H3,(H,13,15) |
| InChIKey | OMCJYOVNKSEMCQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|