C16H31N3O3S — CID 158653992
(3S)-N-methyl-7-(methylamino)-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxoheptanamide (PubChem CID 158653992) has the molecular formula C16H31N3O3S and a molecular weight of 345.51 g/mol. Its IUPAC name is (3S)-N-methyl-7-(methylamino)-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxoheptanamide.
| Compound Name | (3S)-N-methyl-7-(methylamino)-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxoheptanamide |
|---|---|
| PubChem CID | 158653992 |
| Molecular Formula | C16H31N3O3S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (3S)-N-methyl-7-(methylamino)-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxoheptanamide |
| SMILES | CNCCCC(=O)[C@H](CC(=O)NC)N(C)C(=O)CCCCCS |
| InChI | InChI=1S/C16H31N3O3S/c1-17-10-7-8-14(20)13(12-15(21)18-2)19(3)16(22)9-5-4-6-11-23/h13,17,23H,4-12H2,1-3H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | YXZPWKWNGPOXBC-ZDUSSCGKSA-N |
| XLogP | 1.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|