C9H22N2O — CID 163270647
N,N-dimethyl-4-(methylamino)butanamide;ethane (PubChem CID 163270647) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is N,N-dimethyl-4-(methylamino)butanamide;ethane.
| Compound Name | N,N-dimethyl-4-(methylamino)butanamide;ethane |
|---|---|
| PubChem CID | 163270647 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | N,N-dimethyl-4-(methylamino)butanamide;ethane |
| SMILES | CC.CNCCCC(=O)N(C)C |
| InChI | InChI=1S/C7H16N2O.C2H6/c1-8-6-4-5-7(10)9(2)3;1-2/h8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | WJSQYNDPGLNRFM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|