C9H20N2OS — CID 63965989
N,N-dimethyl-4-(2-methylsulfanylethylamino)butanamide (PubChem CID 63965989) has the molecular formula C9H20N2OS and a molecular weight of 204.34 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-methylsulfanylethylamino)butanamide.
| Compound Name | N,N-dimethyl-4-(2-methylsulfanylethylamino)butanamide |
|---|---|
| PubChem CID | 63965989 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N,N-dimethyl-4-(2-methylsulfanylethylamino)butanamide |
| SMILES | CSCCNCCCC(=O)N(C)C |
| InChI | InChI=1S/C9H20N2OS/c1-11(2)9(12)5-4-6-10-7-8-13-3/h10H,4-8H2,1-3H3 |
| InChIKey | NCVJAOQRNGAGFX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|