C8H18N2O2 — CID 64974940
4-(ethoxyamino)-N,N-dimethylbutanamide (PubChem CID 64974940) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 4-(ethoxyamino)-N,N-dimethylbutanamide.
| Compound Name | 4-(ethoxyamino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 64974940 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 4-(ethoxyamino)-N,N-dimethylbutanamide |
| SMILES | CCONCCCC(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O2/c1-4-12-9-7-5-6-8(11)10(2)3/h9H,4-7H2,1-3H3 |
| InChIKey | BEZVJGIXBFTJOP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|