C10H21N3O2 — CID 166186517
4-[[2-(dimethylamino)acetyl]amino]-N,N-dimethylbutanamide (PubChem CID 166186517) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)acetyl]amino]-N,N-dimethylbutanamide.
| Compound Name | 4-[[2-(dimethylamino)acetyl]amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 166186517 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 4-[[2-(dimethylamino)acetyl]amino]-N,N-dimethylbutanamide |
| SMILES | CN(C)CC(=O)NCCCC(=O)N(C)C |
| InChI | InChI=1S/C10H21N3O2/c1-12(2)8-9(14)11-7-5-6-10(15)13(3)4/h5-8H2,1-4H3,(H,11,14) |
| InChIKey | WGYSKGHGKDDOOW-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|