C10H23N3O2 — CID 143571910
N-(2-acetamidoethyl)-2-(dimethylamino)acetamide;ethane (PubChem CID 143571910) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(dimethylamino)acetamide;ethane.
| Compound Name | N-(2-acetamidoethyl)-2-(dimethylamino)acetamide;ethane |
|---|---|
| PubChem CID | 143571910 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(dimethylamino)acetamide;ethane |
| SMILES | CC.CC(=O)NCCNC(=O)CN(C)C |
| InChI | InChI=1S/C8H17N3O2.C2H6/c1-7(12)9-4-5-10-8(13)6-11(2)3;1-2/h4-6H2,1-3H3,(H,9,12)(H,10,13);1-2H3 |
| InChIKey | ISBHNNLADGHRGL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|