C9H14N2O6 — CID 158308072
bis(carbon dioxide);2-(dimethylamino)-N-(3-oxopropyl)acetamide (PubChem CID 158308072) has the molecular formula C9H14N2O6 and a molecular weight of 246.22 g/mol. Its IUPAC name is bis(carbon dioxide);2-(dimethylamino)-N-(3-oxopropyl)acetamide.
| Compound Name | bis(carbon dioxide);2-(dimethylamino)-N-(3-oxopropyl)acetamide |
|---|---|
| PubChem CID | 158308072 |
| Molecular Formula | C9H14N2O6 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | bis(carbon dioxide);2-(dimethylamino)-N-(3-oxopropyl)acetamide |
| SMILES | CN(C)CC(=O)NCCC=O.O=C=O.O=C=O |
| InChI | InChI=1S/C7H14N2O2.2CO2/c1-9(2)6-7(11)8-4-3-5-10;2*2-1-3/h5H,3-4,6H2,1-2H3,(H,8,11);; |
| InChIKey | GNIKZEFFWJHWOH-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|