C13H26N2O2 — CID 106133750
4-[(4-hydroxycyclohexyl)methylamino]-N,N-dimethylbutanamide (PubChem CID 106133750) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-[(4-hydroxycyclohexyl)methylamino]-N,N-dimethylbutanamide.
| Compound Name | 4-[(4-hydroxycyclohexyl)methylamino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 106133750 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-[(4-hydroxycyclohexyl)methylamino]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCNCC1CCC(O)CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-15(2)13(17)4-3-9-14-10-11-5-7-12(16)8-6-11/h11-12,14,16H,3-10H2,1-2H3 |
| InChIKey | PPMWFIBHMAJANU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|