C10H20N2O — CID 62415155
4-(cyclobutylamino)-N,N-dimethylbutanamide (PubChem CID 62415155) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-(cyclobutylamino)-N,N-dimethylbutanamide.
| Compound Name | 4-(cyclobutylamino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 62415155 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-(cyclobutylamino)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCNC1CCC1 |
| InChI | InChI=1S/C10H20N2O/c1-12(2)10(13)7-4-8-11-9-5-3-6-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | KKKZYYQSBZRSIB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|