C12H25N3O — CID 173326763
N,N-dimethyl-5-(piperidin-4-ylamino)pentanamide (PubChem CID 173326763) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is N,N-dimethyl-5-(piperidin-4-ylamino)pentanamide.
| Compound Name | N,N-dimethyl-5-(piperidin-4-ylamino)pentanamide |
|---|---|
| PubChem CID | 173326763 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N,N-dimethyl-5-(piperidin-4-ylamino)pentanamide |
| SMILES | CN(C)C(=O)CCCCNC1CCNCC1 |
| InChI | InChI=1S/C12H25N3O/c1-15(2)12(16)5-3-4-8-14-11-6-9-13-10-7-11/h11,13-14H,3-10H2,1-2H3 |
| InChIKey | IHNLHLJDDKGOMX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|