C12H24N2OS — CID 80599931
N,N-dimethyl-4-(thian-2-ylmethylamino)butanamide (PubChem CID 80599931) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is N,N-dimethyl-4-(thian-2-ylmethylamino)butanamide.
| Compound Name | N,N-dimethyl-4-(thian-2-ylmethylamino)butanamide |
|---|---|
| PubChem CID | 80599931 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N,N-dimethyl-4-(thian-2-ylmethylamino)butanamide |
| SMILES | CN(C)C(=O)CCCNCC1CCCCS1 |
| InChI | InChI=1S/C12H24N2OS/c1-14(2)12(15)7-5-8-13-10-11-6-3-4-9-16-11/h11,13H,3-10H2,1-2H3 |
| InChIKey | TXKAPONNBPLSBS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|