C22H41N5O3S3 — CID 144603372
ethene;[6-[methyl-[(2S)-1-[3-(methylamino)propylamino]-1,4-dioxo-4-(sulfanylamino)butan-2-yl]amino]-6-oxohexyl]sulfanyl (Z)-N-methylbut-2-enimidothioate (PubChem CID 144603372) has the molecular formula C22H41N5O3S3 and a molecular weight of 519.80 g/mol. Its IUPAC name is ethene;[6-[methyl-[(2S)-1-[3-(methylamino)propylamino]-1,4-dioxo-4-(sulfanylamino)butan-2-yl]amino]-6-oxohexyl]sulfanyl (Z)-N-methylbut-2-enimidothioate.
| Compound Name | ethene;[6-[methyl-[(2S)-1-[3-(methylamino)propylamino]-1,4-dioxo-4-(sulfanylamino)butan-2-yl]amino]-6-oxohexyl]sulfanyl (Z)-N-methylbut-2-enimidothioate |
|---|---|
| PubChem CID | 144603372 |
| Molecular Formula | C22H41N5O3S3 |
| Molecular Weight | 519.80 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | ethene;[6-[methyl-[(2S)-1-[3-(methylamino)propylamino]-1,4-dioxo-4-(sulfanylamino)butan-2-yl]amino]-6-oxohexyl]sulfanyl (Z)-N-methylbut-2-enimidothioate |
| SMILES | C/C=C\C(=N/C)SSCCCCCC(=O)N(C)[C@@H](CC(=O)NS)C(=O)NCCCNC.C=C |
| InChI | InChI=1S/C20H37N5O3S3.C2H4/c1-5-10-18(22-3)31-30-14-8-6-7-11-19(27)25(4)16(15-17(26)24-29)20(28)23-13-9-12-21-2;1-2/h5,10,16,21,29H,6-9,11-15H2,1-4H3,(H,23,28)(H,24,26);1-2H2/b10-5-,22-18+;/t16-;/m0./s1 |
| InChIKey | GWOHOYZSEOEHJN-CQTRBQCOSA-N |
| XLogP | 3.24 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|