C18H36N3O2S+ — CID 153363417
trimethyl-[2-[[4-methyl-2-[methyl(6-sulfanylhexanoyl)amino]pent-4-enoyl]amino]ethyl]azanium (PubChem CID 153363417) has the molecular formula C18H36N3O2S+ and a molecular weight of 358.57 g/mol. Its IUPAC name is trimethyl-[2-[[4-methyl-2-[methyl(6-sulfanylhexanoyl)amino]pent-4-enoyl]amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[4-methyl-2-[methyl(6-sulfanylhexanoyl)amino]pent-4-enoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 153363417 |
| Molecular Formula | C18H36N3O2S+ |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | trimethyl-[2-[[4-methyl-2-[methyl(6-sulfanylhexanoyl)amino]pent-4-enoyl]amino]ethyl]azanium |
| SMILES | C=C(C)CC(C(=O)NCC[N+](C)(C)C)N(C)C(=O)CCCCCS |
| InChI | InChI=1S/C18H35N3O2S/c1-15(2)14-16(18(23)19-11-12-21(4,5)6)20(3)17(22)10-8-7-9-13-24/h16H,1,7-14H2,2-6H3,(H-,19,23,24)/p+1 |
| InChIKey | VOZMKDWCWUSSOW-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|