C14H28BN3O4 — CID 54565022
3-[[hydroxy(methyl)boranyl]amino]-2-[methyl-[6-(prop-1-en-2-ylamino)hexanoyl]amino]propanoic acid (PubChem CID 54565022) has the molecular formula C14H28BN3O4 and a molecular weight of 313.21 g/mol. Its IUPAC name is 3-[[hydroxy(methyl)boranyl]amino]-2-[methyl-[6-(prop-1-en-2-ylamino)hexanoyl]amino]propanoic acid.
| Compound Name | 3-[[hydroxy(methyl)boranyl]amino]-2-[methyl-[6-(prop-1-en-2-ylamino)hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54565022 |
| Molecular Formula | C14H28BN3O4 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 3-[[hydroxy(methyl)boranyl]amino]-2-[methyl-[6-(prop-1-en-2-ylamino)hexanoyl]amino]propanoic acid |
| SMILES | C=C(C)NCCCCCC(=O)N(C)C(CNB(C)O)C(=O)O |
| InChI | InChI=1S/C14H28BN3O4/c1-11(2)16-9-7-5-6-8-13(19)18(4)12(14(20)21)10-17-15(3)22/h12,16-17,22H,1,5-10H2,2-4H3,(H,20,21) |
| InChIKey | CQRYJQHSJROCBB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|