C13H21FN2O4S2 — CID 113065646
N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-fluorobenzenesulfonamide (PubChem CID 113065646) has the molecular formula C13H21FN2O4S2 and a molecular weight of 352.45 g/mol. Its IUPAC name is N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 113065646 |
| Molecular Formula | C13H21FN2O4S2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-fluorobenzenesulfonamide |
| SMILES | CCC(C)N(CCNS(=O)(=O)c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H21FN2O4S2/c1-4-11(2)16(21(3,17)18)10-9-15-22(19,20)13-7-5-12(14)6-8-13/h5-8,11,15H,4,9-10H2,1-3H3 |
| InChIKey | APNIBHCLGWWPOH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |