C14H24N2O5S2 — CID 113065648
N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methoxybenzenesulfonamide (PubChem CID 113065648) has the molecular formula C14H24N2O5S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113065648 |
| Molecular Formula | C14H24N2O5S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methoxybenzenesulfonamide |
| SMILES | CCC(C)N(CCNS(=O)(=O)c1ccc(OC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C14H24N2O5S2/c1-5-12(2)16(22(4,17)18)11-10-15-23(19,20)14-8-6-13(21-3)7-9-14/h6-9,12,15H,5,10-11H2,1-4H3 |
| InChIKey | CUOMVZSLSSVJJO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |