C19H26N2O6S2 — CID 3409975
4-methoxy-N-[3-[(4-methoxyphenyl)sulfonylamino]pentyl]benzenesulfonamide (PubChem CID 3409975) has the molecular formula C19H26N2O6S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-methoxy-N-[3-[(4-methoxyphenyl)sulfonylamino]pentyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[3-[(4-methoxyphenyl)sulfonylamino]pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3409975 |
| Molecular Formula | C19H26N2O6S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-methoxy-N-[3-[(4-methoxyphenyl)sulfonylamino]pentyl]benzenesulfonamide |
| SMILES | CCC(CCNS(=O)(=O)c1ccc(OC)cc1)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H26N2O6S2/c1-4-15(21-29(24,25)19-11-7-17(27-3)8-12-19)13-14-20-28(22,23)18-9-5-16(26-2)6-10-18/h5-12,15,20-21H,4,13-14H2,1-3H3 |
| InChIKey | UELQAAIAEYHTPK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |