C10H10F2O3 — CID 63668220
4-(2,3-difluorophenyl)-4-hydroxybutanoic acid (PubChem CID 63668220) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)-4-hydroxybutanoic acid.
| Compound Name | 4-(2,3-difluorophenyl)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 63668220 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 4-(2,3-difluorophenyl)-4-hydroxybutanoic acid |
| SMILES | O=C(O)CCC(O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H10F2O3/c11-7-3-1-2-6(10(7)12)8(13)4-5-9(14)15/h1-3,8,13H,4-5H2,(H,14,15) |
| InChIKey | VVDAZVNCBFEJJK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |