3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid

C9H6F4O3 — CID 63667269

IUPAC3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid
SMILESO=C(O)C(F)(F)C(O)c1cccc(F)c1F
InChIInChI=1S/C9H6F4O3/c10-5-3-1-2-4(6(5)11)7(14)9(12,13)8(15)16/h1-3,7,14H,(H,15,16)
InChIKeyUTCPWUWFTFBXPM-UHFFFAOYSA-N
MW238.14 g/mol
LogP1.72
Rot. Bonds3

About 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid

3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid (PubChem CID 63667269) has the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid.

Molecular Properties

Compound Name3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid
PubChem CID63667269
Molecular FormulaC9H6F4O3
Molecular Weight238.14 g/mol
Exact Mass238.03
IUPAC Name3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid
SMILESO=C(O)C(F)(F)C(O)c1cccc(F)c1F
InChIInChI=1S/C9H6F4O3/c10-5-3-1-2-4(6(5)11)7(14)9(12,13)8(15)16/h1-3,7,14H,(H,15,16)
InChIKeyUTCPWUWFTFBXPM-UHFFFAOYSA-N
XLogP1.72
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.14
LogP ≤ 51.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid?
The IUPAC name of 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid (CID 63667269) is 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid.
What is the SMILES notation for 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid?
The canonical SMILES for 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid is O=C(O)C(F)(F)C(O)c1cccc(F)c1F.
What is the InChIKey of 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid?
The InChIKey is UTCPWUWFTFBXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F4O3/c10-5-3-1-2-4(6(5)11)7(14)9(12,13)8(15)16/h1-3,7,14H,(H,15,16).
What are the key properties of 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid?
3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid has a molecular weight of 238.14 g/mol, XLogP of 1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-difluorophenyl)-2,2-difluoro-3-hydroxypropanoic acid is sourced from PubChem (CID 63667269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).