C9H6F4O2 — CID 105478777
2,2,3-trifluoro-3-(2-fluorophenyl)propanoic acid (PubChem CID 105478777) has the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. Its IUPAC name is 2,2,3-trifluoro-3-(2-fluorophenyl)propanoic acid.
| Compound Name | 2,2,3-trifluoro-3-(2-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 105478777 |
| Molecular Formula | C9H6F4O2 |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2,2,3-trifluoro-3-(2-fluorophenyl)propanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)c1ccccc1F |
| InChI | InChI=1S/C9H6F4O2/c10-6-4-2-1-3-5(6)7(11)9(12,13)8(14)15/h1-4,7H,(H,14,15) |
| InChIKey | ZXYNRSPTXUJIEA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |